Products 1932033-53-8
CAS 1932033-53-8 is the registry number for tert-Butyl (1S,2R,5R)-2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (1S,2R,5R)-2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate (CAS 1932033-53-8) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl (1S,2R,5R)-2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate. InChIKey: SRRXFFKYXKCTOS-CIUDSAMLSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl (1S,2R,5R)-2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | SRRXFFKYXKCTOS-CIUDSAMLSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@@H]2[C@@H]1CO |
Computed by PubChem (NCBI)