CAS 1932045-84-5 is the registry number for (1S,2S)-Ethyl 2-((tert-butoxycarbonyl)amino)cyclopropanecarboxylate, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-ethyl (1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate (CAS 1932045-84-5) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: trans-ethyl (1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate. InChIKey: WQCFOWMOJLYSPS-YUMQZZPRSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | trans-ethyl (1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate |
| InChIKey | WQCFOWMOJLYSPS-YUMQZZPRSA-N |
| SMILES | CCOC(=O)[C@H]1C[C@@H]1NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)