CAS 1932140-94-7 is the registry number for (1S,5R)-8-Oxa-3-azabicyclo[3.2.1]octan-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,5R)-8-oxa-3-azabicyclo[3.2.1]octan-2-one (CAS 1932140-94-7) is a chemical compound with the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. IUPAC name: (1S,5R)-8-oxa-3-azabicyclo[3.2.1]octan-2-one. InChIKey: MNYUSIQFKHKEQT-UHNVWZDZSA-N.
| Molecular formula | C6H9NO2 |
|---|---|
| Molecular weight | 127.14 g/mol |
| IUPAC name | (1S,5R)-8-oxa-3-azabicyclo[3.2.1]octan-2-one |
| InChIKey | MNYUSIQFKHKEQT-UHNVWZDZSA-N |
| SMILES | C1C[C@H]2C(=O)NC[C@@H]1O2 |
Computed by PubChem (NCBI)