Products 193224-24-7
CAS 193224-24-7 is the registry number for Cis-moschamine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 50mg, 25mg, Get quote.
(Z)-N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide (CAS 193224-24-7) is a chemical compound with the molecular formula C20H20N2O4 and a molecular weight of 352.4 g/mol. IUPAC name: (Z)-N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide. InChIKey: WGHKJYWENWLOMY-CLTKARDFSA-N.
| Molecular formula | C20H20N2O4 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | (Z)-N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
| InChIKey | WGHKJYWENWLOMY-CLTKARDFSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C\C(=O)NCCC2=CNC3=C2C=C(C=C3)O)O |
Computed by PubChem (NCBI)
Synonyms:
cis-Moschamine, orb1680186