CAS 94594-90-8 appears in our catalog under these names: (1S)-Camphorsultam, (–)–10,2–Camphorsultam, (1S,2R)-(-)-10,2-Camphorsultam, 99% , (-)-10,2-Camphorsultam, >98.0%(GC), (1S)-(-)-2,10-Camphorsultam 99%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 1g, 2g, 5g, 100g, 25g, 500g, 50g, 250g.
10,10-dimethyl-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide (CAS 94594-90-8) is a chemical compound with the molecular formula C10H17NO2S and a molecular weight of 215.31 g/mol. IUPAC name: 10,10-dimethyl-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide. InChIKey: DPJYJNYYDJOJNO-UHFFFAOYSA-N.
| Molecular formula | C10H17NO2S |
|---|---|
| Molecular weight | 215.31 g/mol |
| IUPAC name | 10,10-dimethyl-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide |
| InChIKey | DPJYJNYYDJOJNO-UHFFFAOYSA-N |
| SMILES | CC1(C2CCC13CS(=O)(=O)NC3C2)C |
Computed by PubChem (NCBI)