CAS 1932315-55-3 is the registry number for tert-Butyl (3R,4R)-3-(aminomethyl)-4-hydroxypiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R,4R)-3-(aminomethyl)-4-hydroxypiperidine-1-carboxylate (CAS 1932315-55-3) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl (3R,4R)-3-(aminomethyl)-4-hydroxypiperidine-1-carboxylate. InChIKey: RIMYCVANDMMPSG-RKDXNWHRSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-(aminomethyl)-4-hydroxypiperidine-1-carboxylate |
| InChIKey | RIMYCVANDMMPSG-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H](C1)CN)O |
Computed by PubChem (NCBI)