Products 1932330-83-0
CAS 1932330-83-0 appears in our catalog under these names: Darunavir Impurity 10, Darunavir Impurity 6, (3aR,4R,6aS)-4-Methoxytetrahydrofuro(3,4-b)furan-2(3H)-one. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(3aR,4R,6aS)-4-methoxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one (CAS 1932330-83-0) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: (3aR,4R,6aS)-4-methoxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one. InChIKey: LQEIOPTZKCKTPQ-WYDQCIBASA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | (3aR,4R,6aS)-4-methoxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one |
| InChIKey | LQEIOPTZKCKTPQ-WYDQCIBASA-N |
| SMILES | CO[C@H]1[C@@H]2CC(=O)O[C@@H]2CO1 |
Computed by PubChem (NCBI)