Products 866594-61-8
CAS 866594-61-8 appears in our catalog under these names: Darunavir Impurity 7, Darunavir Impurity 9, (3aS,4R,6aR)-Tetrahydro-4-methoxyfuro(3,4-b)furan-2(3H)-one. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
(3aS,4R,6aR)-4-methoxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one (CAS 866594-61-8) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: (3aS,4R,6aR)-4-methoxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one. InChIKey: LQEIOPTZKCKTPQ-KZLJYQGOSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | (3aS,4R,6aR)-4-methoxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one |
| InChIKey | LQEIOPTZKCKTPQ-KZLJYQGOSA-N |
| SMILES | CO[C@H]1[C@H]2CC(=O)O[C@H]2CO1 |
Computed by PubChem (NCBI)