CAS 1932333-90-8 is the registry number for (3R,5R)-tert-Butyl 3-amino-5-methylpiperidine-1-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl (3R,5R)-3-amino-5-methylpiperidine-1-carboxylate (CAS 1932333-90-8) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl (3R,5R)-3-amino-5-methylpiperidine-1-carboxylate. InChIKey: PLLHWQMECGKRCY-RKDXNWHRSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl (3R,5R)-3-amino-5-methylpiperidine-1-carboxylate |
| InChIKey | PLLHWQMECGKRCY-RKDXNWHRSA-N |
| SMILES | C[C@@H]1C[C@H](CN(C1)C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)