CAS 1932350-97-4 is the registry number for (3S,4R)-tert-Butyl 3,4-diaminopiperidine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Tert-butyl (3S,4R)-3,4-diaminopiperidine-1-carboxylate (CAS 1932350-97-4) is a chemical compound with the molecular formula C10H21N3O2 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (3S,4R)-3,4-diaminopiperidine-1-carboxylate. InChIKey: UJLDFDMDAGJZSV-SFYZADRCSA-N.
| Molecular formula | C10H21N3O2 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3,4-diaminopiperidine-1-carboxylate |
| InChIKey | UJLDFDMDAGJZSV-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)N)N |
Computed by PubChem (NCBI)