Products 1932396-57-0
CAS 1932396-57-0 appears in our catalog under these names: tert-Butyl n-[cis-2-methylazetidin-3-yl]carbamate hydrochloride, 95%, tert-butyl N-((2R,3R)-2-methylazetidin-3-yl)carbamate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl N-[(2R,3R)-2-methylazetidin-3-yl]carbamate (CAS 1932396-57-0) is a chemical compound with the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. IUPAC name: tert-butyl N-[(2R,3R)-2-methylazetidin-3-yl]carbamate. InChIKey: LXXPLHYWFLINDJ-RNFRBKRXSA-N.
| Molecular formula | C9H18N2O2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | tert-butyl N-[(2R,3R)-2-methylazetidin-3-yl]carbamate |
| InChIKey | LXXPLHYWFLINDJ-RNFRBKRXSA-N |
| SMILES | C[C@@H]1[C@@H](CN1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)