Products 2007915-43-5

CAS 2007915-43-5 is the registry number for tert-Butyl n-(2-methylazetidin-3-yl)carbamate,cis-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(2R,3R)-2-methylazetidin-3-yl]carbamate (CAS 2007915-43-5) is a chemical compound with the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. IUPAC name: tert-butyl N-[(2R,3R)-2-methylazetidin-3-yl]carbamate. InChIKey: LXXPLHYWFLINDJ-RNFRBKRXSA-N.

Identity
Molecular formulaC9H18N2O2
Molecular weight186.25 g/mol
IUPAC nametert-butyl N-[(2R,3R)-2-methylazetidin-3-yl]carbamate
InChIKeyLXXPLHYWFLINDJ-RNFRBKRXSA-N
SMILESC[C@@H]1[C@@H](CN1)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)