CAS 2007915-43-5 is the registry number for tert-Butyl n-(2-methylazetidin-3-yl)carbamate,cis-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-[(2R,3R)-2-methylazetidin-3-yl]carbamate (CAS 2007915-43-5) is a chemical compound with the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. IUPAC name: tert-butyl N-[(2R,3R)-2-methylazetidin-3-yl]carbamate. InChIKey: LXXPLHYWFLINDJ-RNFRBKRXSA-N.
| Molecular formula | C9H18N2O2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | tert-butyl N-[(2R,3R)-2-methylazetidin-3-yl]carbamate |
| InChIKey | LXXPLHYWFLINDJ-RNFRBKRXSA-N |
| SMILES | C[C@@H]1[C@@H](CN1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)