CAS 1932411-98-7 is the registry number for Nirmatrelvir Impurity 64. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (1R,2R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate (CAS 1932411-98-7) is a chemical compound with the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. IUPAC name: methyl (1R,2R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate. InChIKey: KCIDWDVSBWPHLH-LYFYHCNISA-N.
| Molecular formula | C9H15NO2 |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | methyl (1R,2R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate |
| InChIKey | KCIDWDVSBWPHLH-LYFYHCNISA-N |
| SMILES | CC1([C@@H]2[C@H]1[C@@H](NC2)C(=O)OC)C |
Computed by PubChem (NCBI)