CAS 1932509-68-6 is the registry number for (2S,3R)-Benzyl 3-amino-2-methylpiperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Benzyl (2S,3R)-3-amino-2-methylpiperidine-1-carboxylate (CAS 1932509-68-6) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl (2S,3R)-3-amino-2-methylpiperidine-1-carboxylate. InChIKey: DQLSXOAEXCBESC-WCQYABFASA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl (2S,3R)-3-amino-2-methylpiperidine-1-carboxylate |
| InChIKey | DQLSXOAEXCBESC-WCQYABFASA-N |
| SMILES | C[C@H]1[C@@H](CCCN1C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)