CAS 1932572-89-8 is the registry number for Benzyl (2r,3s)-3-amino-2-methylpiperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Benzyl (2R,3S)-3-amino-2-methylpiperidine-1-carboxylate (CAS 1932572-89-8) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl (2R,3S)-3-amino-2-methylpiperidine-1-carboxylate. InChIKey: DQLSXOAEXCBESC-YPMHNXCESA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl (2R,3S)-3-amino-2-methylpiperidine-1-carboxylate |
| InChIKey | DQLSXOAEXCBESC-YPMHNXCESA-N |
| SMILES | C[C@@H]1[C@H](CCCN1C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)