CAS 1932579-16-2 is the registry number for tert-Butyl (3R,4R)-3,4-dihydroxypiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R,4R)-3,4-dihydroxypiperidine-1-carboxylate (CAS 1932579-16-2) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl (3R,4R)-3,4-dihydroxypiperidine-1-carboxylate. InChIKey: RIZGRNBWPJMDKU-HTQZYQBOSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3,4-dihydroxypiperidine-1-carboxylate |
| InChIKey | RIZGRNBWPJMDKU-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H](C1)O)O |
Computed by PubChem (NCBI)