CAS 1932661-67-0 appears in our catalog under these names: tert-Butyl (2S,4R)-2-(aminomethyl)-4-hydroxypyrrolidine-1-carboxylate, 98%, tert-Butyl (2S,4R)-2-(aminomethyl)-4-hydroxypyrrolidine-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 25mg.
Tert-butyl (2S,4R)-2-(aminomethyl)-4-hydroxypyrrolidine-1-carboxylate (CAS 1932661-67-0) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (2S,4R)-2-(aminomethyl)-4-hydroxypyrrolidine-1-carboxylate. InChIKey: QWQOVHQSXJGTPM-JGVFFNPUSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (2S,4R)-2-(aminomethyl)-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | QWQOVHQSXJGTPM-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1CN)O |
Computed by PubChem (NCBI)