CAS 1932800-41-3 appears in our catalog under these names: (2R,4R)-tert-Butyl 2-(aminomethyl)-4-hydroxypyrrolidine-1-carboxylate, 98+%, tert-Butyl (2R,4R)-2-(aminomethyl)-4-hydroxypyrrolidine-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl (2R,4R)-2-(aminomethyl)-4-hydroxypyrrolidine-1-carboxylate (CAS 1932800-41-3) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (2R,4R)-2-(aminomethyl)-4-hydroxypyrrolidine-1-carboxylate. InChIKey: QWQOVHQSXJGTPM-HTQZYQBOSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (2R,4R)-2-(aminomethyl)-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | QWQOVHQSXJGTPM-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@@H]1CN)O |
Computed by PubChem (NCBI)