Products 1932791-40-6

CAS 1932791-40-6 is the registry number for (1R,3S)-3-Methoxycyclopentane-1-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g, 100mg, 5g.

Cis-(1R,3S)-3-methoxycyclopentane-1-carboxylic acid (CAS 1932791-40-6) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. IUPAC name: cis-(1R,3S)-3-methoxycyclopentane-1-carboxylic acid. InChIKey: PJEAKWXFTMRJMA-RITPCOANSA-N.

Identity
Molecular formulaC7H12O3
Molecular weight144.17 g/mol
IUPAC namecis-(1R,3S)-3-methoxycyclopentane-1-carboxylic acid
InChIKeyPJEAKWXFTMRJMA-RITPCOANSA-N
SMILESCO[C@H]1CC[C@H](C1)C(=O)O

Computed by PubChem (NCBI)