Products 2166081-67-8

CAS 2166081-67-8 is the registry number for (1S,3R)-3-Methoxycyclopentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Cis-(1S,3R)-3-methoxycyclopentane-1-carboxylic acid (CAS 2166081-67-8) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. IUPAC name: cis-(1S,3R)-3-methoxycyclopentane-1-carboxylic acid. InChIKey: PJEAKWXFTMRJMA-NTSWFWBYSA-N.

Identity
Molecular formulaC7H12O3
Molecular weight144.17 g/mol
IUPAC namecis-(1S,3R)-3-methoxycyclopentane-1-carboxylic acid
InChIKeyPJEAKWXFTMRJMA-NTSWFWBYSA-N
SMILESCO[C@@H]1CC[C@@H](C1)C(=O)O

Computed by PubChem (NCBI)