CAS 2166081-67-8 is the registry number for (1S,3R)-3-Methoxycyclopentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1S,3R)-3-methoxycyclopentane-1-carboxylic acid (CAS 2166081-67-8) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. IUPAC name: cis-(1S,3R)-3-methoxycyclopentane-1-carboxylic acid. InChIKey: PJEAKWXFTMRJMA-NTSWFWBYSA-N.
| Molecular formula | C7H12O3 |
|---|---|
| Molecular weight | 144.17 g/mol |
| IUPAC name | cis-(1S,3R)-3-methoxycyclopentane-1-carboxylic acid |
| InChIKey | PJEAKWXFTMRJMA-NTSWFWBYSA-N |
| SMILES | CO[C@@H]1CC[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)