CAS 1933460-23-1 is the registry number for AZM198, 98.40%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 25 mg, 100 mg, 50 mg.
1-[[2-(aminomethyl)-4-chlorophenyl]methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one (CAS 1933460-23-1) is a chemical compound with the molecular formula C14H13ClN4OS and a molecular weight of 320.8 g/mol. IUPAC name: 1-[[2-(aminomethyl)-4-chlorophenyl]methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one. InChIKey: MFCVOLWLNXXQFY-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN4OS |
|---|---|
| Molecular weight | 320.8 g/mol |
| IUPAC name | 1-[[2-(aminomethyl)-4-chlorophenyl]methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| InChIKey | MFCVOLWLNXXQFY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CN)CN2C3=C(C(=O)NC2=S)NC=C3 |
Computed by PubChem (NCBI)