CAS 73216-93-0 is the registry number for (2-aminophenyl)-N-((((4-chlorophenyl)amino)thioxomethyl)amino)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
1-[(2-aminobenzoyl)amino]-3-(4-chlorophenyl)thiourea (CAS 73216-93-0) is a chemical compound with the molecular formula C14H13ClN4OS and a molecular weight of 320.8 g/mol. IUPAC name: 1-[(2-aminobenzoyl)amino]-3-(4-chlorophenyl)thiourea. InChIKey: JRAJDYGHPKGWNH-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN4OS |
|---|---|
| Molecular weight | 320.8 g/mol |
| IUPAC name | 1-[(2-aminobenzoyl)amino]-3-(4-chlorophenyl)thiourea |
| InChIKey | JRAJDYGHPKGWNH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NNC(=S)NC2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)