Products 1934601-38-3
CAS 1934601-38-3 is the registry number for 7-bromo-5-methylbenzo[b]thiophene-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-bromo-5-methyl-1-benzothiophene-2-carboxylic acid (CAS 1934601-38-3) is a chemical compound with the molecular formula C10H7BrO2S and a molecular weight of 271.13 g/mol. IUPAC name: 7-bromo-5-methyl-1-benzothiophene-2-carboxylic acid. InChIKey: KISKPTQLSSHJDF-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO2S |
|---|---|
| Molecular weight | 271.13 g/mol |
| IUPAC name | 7-bromo-5-methyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | KISKPTQLSSHJDF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)Br)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)