Products 1934640-17-1
CAS 1934640-17-1 is the registry number for tert-Butyl (2-amino-2-thioxoethyl)(tert-butyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(2-amino-2-sulfanylideneethyl)-N-tert-butylcarbamate (CAS 1934640-17-1) is a chemical compound with the molecular formula C11H22N2O2S and a molecular weight of 246.37 g/mol. IUPAC name: tert-butyl N-(2-amino-2-sulfanylideneethyl)-N-tert-butylcarbamate. InChIKey: KCAUCANWQIVJIE-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O2S |
|---|---|
| Molecular weight | 246.37 g/mol |
| IUPAC name | tert-butyl N-(2-amino-2-sulfanylideneethyl)-N-tert-butylcarbamate |
| InChIKey | KCAUCANWQIVJIE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N(CC(=S)N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)