Products 2311888-27-2
CAS 2311888-27-2 is the registry number for rel-(1R,3s,5S)-9-(Ethylsulfonyl)-N-methyl-9-azabicyclo[3.3.1]nonan-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,5R)-9-ethylsulfonyl-N-methyl-9-azabicyclo[3.3.1]nonan-3-amine (CAS 2311888-27-2) is a chemical compound with the molecular formula C11H22N2O2S and a molecular weight of 246.37 g/mol. IUPAC name: (1S,5R)-9-ethylsulfonyl-N-methyl-9-azabicyclo[3.3.1]nonan-3-amine. InChIKey: MWNNUUNWJAVUHJ-FGWVZKOKSA-N.
| Molecular formula | C11H22N2O2S |
|---|---|
| Molecular weight | 246.37 g/mol |
| IUPAC name | (1S,5R)-9-ethylsulfonyl-N-methyl-9-azabicyclo[3.3.1]nonan-3-amine |
| InChIKey | MWNNUUNWJAVUHJ-FGWVZKOKSA-N |
| SMILES | CCS(=O)(=O)N1[C@@H]2CCC[C@H]1CC(C2)NC |
Computed by PubChem (NCBI)