CAS 1934800-21-1 is the registry number for 3,4-Dimethylphthalonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
3,4-dimethylbenzene-1,2-dicarbonitrile (CAS 1934800-21-1) is a chemical compound with the molecular formula C10H8N2 and a molecular weight of 156.18 g/mol. IUPAC name: 3,4-dimethylbenzene-1,2-dicarbonitrile. InChIKey: CIULPBFCSZUVLV-UHFFFAOYSA-N.
| Molecular formula | C10H8N2 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | 3,4-dimethylbenzene-1,2-dicarbonitrile |
| InChIKey | CIULPBFCSZUVLV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C#N)C#N)C |
Computed by PubChem (NCBI)