CAS 36715-95-4 is the registry number for 3,4–Dimethylphthalonitrile. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
3,4-dimethylbenzene-1,2-dicarbonitrile (CAS 36715-95-4) is a chemical compound with the molecular formula C10H8N2 and a molecular weight of 156.18 g/mol. IUPAC name: 3,4-dimethylbenzene-1,2-dicarbonitrile. InChIKey: CIULPBFCSZUVLV-UHFFFAOYSA-N.
| Molecular formula | C10H8N2 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | 3,4-dimethylbenzene-1,2-dicarbonitrile |
| InChIKey | CIULPBFCSZUVLV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C#N)C#N)C |
Computed by PubChem (NCBI)