Products 1934819-84-7
CAS 1934819-84-7 is the registry number for Benzyl 1-hydroxy-3-azabicyclo[3.1.0]hexane-3-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
Benzyl 1-hydroxy-3-azabicyclo[3.1.0]hexane-3-carboxylate (CAS 1934819-84-7) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: benzyl 1-hydroxy-3-azabicyclo[3.1.0]hexane-3-carboxylate. InChIKey: VYYBXCTXLYCERX-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | benzyl 1-hydroxy-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | VYYBXCTXLYCERX-UHFFFAOYSA-N |
| SMILES | C1C2C1(CN(C2)C(=O)OCC3=CC=CC=C3)O |
Computed by PubChem (NCBI)