CAS 1934834-95-3 appears in our catalog under these names: 3-Bromopyridine-2-sulfonyl fluoride, 95%, 3-Bromopyridine-2-sulfonyl fluoride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-bromopyridine-2-sulfonyl fluoride (CAS 1934834-95-3) is a chemical compound with the molecular formula C5H3BrFNO2S and a molecular weight of 240.05 g/mol. IUPAC name: 3-bromopyridine-2-sulfonyl fluoride. InChIKey: MHBNAFLMGUQAHC-UHFFFAOYSA-N.
| Molecular formula | C5H3BrFNO2S |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 3-bromopyridine-2-sulfonyl fluoride |
| InChIKey | MHBNAFLMGUQAHC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)S(=O)(=O)F)Br |
Computed by PubChem (NCBI)