Products 2229049-79-8

CAS 2229049-79-8 is the registry number for 3-Bromopyridine-4-sulfonyl fluoride, 98%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-bromopyridine-4-sulfonyl fluoride (CAS 2229049-79-8) is a chemical compound with the molecular formula C5H3BrFNO2S and a molecular weight of 240.05 g/mol. IUPAC name: 3-bromopyridine-4-sulfonyl fluoride. InChIKey: HASYIRVLOUAZOM-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3BrFNO2S
Molecular weight240.05 g/mol
IUPAC name3-bromopyridine-4-sulfonyl fluoride
InChIKeyHASYIRVLOUAZOM-UHFFFAOYSA-N
SMILESC1=CN=CC(=C1S(=O)(=O)F)Br

Computed by PubChem (NCBI)