Products 1934901-15-1

CAS 1934901-15-1 is the registry number for 2-(4-(Fluoromethyl)-1H-1,2,3-triazol-1-yl)-2-methylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[4-(fluoromethyl)triazol-1-yl]-2-methylpropanoic acid (CAS 1934901-15-1) is a chemical compound with the molecular formula C7H10FN3O2 and a molecular weight of 187.17 g/mol. IUPAC name: 2-[4-(fluoromethyl)triazol-1-yl]-2-methylpropanoic acid. InChIKey: PGWCRLFFQMLCKO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10FN3O2
Molecular weight187.17 g/mol
IUPAC name2-[4-(fluoromethyl)triazol-1-yl]-2-methylpropanoic acid
InChIKeyPGWCRLFFQMLCKO-UHFFFAOYSA-N
SMILESCC(C)(C(=O)O)N1C=C(N=N1)CF

Computed by PubChem (NCBI)