CAS 1934901-15-1 is the registry number for 2-(4-(Fluoromethyl)-1H-1,2,3-triazol-1-yl)-2-methylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(fluoromethyl)triazol-1-yl]-2-methylpropanoic acid (CAS 1934901-15-1) is a chemical compound with the molecular formula C7H10FN3O2 and a molecular weight of 187.17 g/mol. IUPAC name: 2-[4-(fluoromethyl)triazol-1-yl]-2-methylpropanoic acid. InChIKey: PGWCRLFFQMLCKO-UHFFFAOYSA-N.
| Molecular formula | C7H10FN3O2 |
|---|---|
| Molecular weight | 187.17 g/mol |
| IUPAC name | 2-[4-(fluoromethyl)triazol-1-yl]-2-methylpropanoic acid |
| InChIKey | PGWCRLFFQMLCKO-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)N1C=C(N=N1)CF |
Computed by PubChem (NCBI)