Products 70050-43-0

CAS 70050-43-0 is the registry number for 2-((1H-Imidazol-4-yl)methyl)-2-amino-3-fluoropropanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-amino-2-(fluoromethyl)-3-(1H-imidazol-5-yl)propanoic acid (CAS 70050-43-0) is a chemical compound with the molecular formula C7H10FN3O2 and a molecular weight of 187.17 g/mol. IUPAC name: 2-amino-2-(fluoromethyl)-3-(1H-imidazol-5-yl)propanoic acid. InChIKey: AJFGLTPLWPTALJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10FN3O2
Molecular weight187.17 g/mol
IUPAC name2-amino-2-(fluoromethyl)-3-(1H-imidazol-5-yl)propanoic acid
InChIKeyAJFGLTPLWPTALJ-UHFFFAOYSA-N
SMILESC1=C(NC=N1)CC(CF)(C(=O)O)N

Computed by PubChem (NCBI)