Products 1934940-61-0

CAS 1934940-61-0 appears in our catalog under these names: 2,4-Dichlorothiophene-3-carboxylic acid, 97%, 2,4-Dichlorothiophene-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2,4-dichlorothiophene-3-carboxylic acid (CAS 1934940-61-0) is a chemical compound with the molecular formula C5H2Cl2O2S and a molecular weight of 197.04 g/mol. IUPAC name: 2,4-dichlorothiophene-3-carboxylic acid. InChIKey: XTOUOEZOPXVPSF-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2Cl2O2S
Molecular weight197.04 g/mol
IUPAC name2,4-dichlorothiophene-3-carboxylic acid
InChIKeyXTOUOEZOPXVPSF-UHFFFAOYSA-N
SMILESC1=C(C(=C(S1)Cl)C(=O)O)Cl

Computed by PubChem (NCBI)