CAS 61209-02-7 appears in our catalog under these names: 3,4-Chloro-2-Thiophene Carboxylic Acid, 3,4-Dichlorothiophene-2-carboxylic Acid, 3,4–Dichlorothiophene–2–carboxylic acid, 3,4-Dichlorothiophene-2-carboxylic acid 98%, 3,4-Dichlorothiophene-2-carboxylic acid, 98%, 98%. Offered by: Chemat Brand, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: on request, 50mg, 100mg, 250mg, 1g.
3,4-dichlorothiophene-2-carboxylic acid (CAS 61209-02-7) is a chemical compound with the molecular formula C5H2Cl2O2S and a molecular weight of 197.04 g/mol. IUPAC name: 3,4-dichlorothiophene-2-carboxylic acid. InChIKey: SHYXCAMRUUVZKJ-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2O2S |
|---|---|
| Molecular weight | 197.04 g/mol |
| IUPAC name | 3,4-dichlorothiophene-2-carboxylic acid |
| InChIKey | SHYXCAMRUUVZKJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(S1)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)