CAS 321309-29-9 is the registry number for 6-Fluoro-4H-benzo[d][1,3]dioxine-8-carbonyl chloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-4H-1,3-benzodioxine-8-carbonyl chloride (CAS 321309-29-9) is a chemical compound with the molecular formula C9H6ClFO3 and a molecular weight of 216.59 g/mol. IUPAC name: 6-fluoro-4H-1,3-benzodioxine-8-carbonyl chloride. InChIKey: BVBRUBNOWFISPE-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO3 |
|---|---|
| Molecular weight | 216.59 g/mol |
| IUPAC name | 6-fluoro-4H-1,3-benzodioxine-8-carbonyl chloride |
| InChIKey | BVBRUBNOWFISPE-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)F)C(=O)Cl)OCO1 |
Computed by PubChem (NCBI)