CAS 1935603-31-8 is the registry number for 3,5-Dimethyl-1-(2,2,2-trifluoroethyl)-1h-pyrazol-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol (CAS 1935603-31-8) is a chemical compound with the molecular formula C7H9F3N2O and a molecular weight of 194.15 g/mol. IUPAC name: 3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol. InChIKey: AUTFYHCEEIQSNR-UHFFFAOYSA-N.
| Molecular formula | C7H9F3N2O |
|---|---|
| Molecular weight | 194.15 g/mol |
| IUPAC name | 3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol |
| InChIKey | AUTFYHCEEIQSNR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(F)(F)F)C)O |
Computed by PubChem (NCBI)