CAS 2228136-05-6 is the registry number for 1-(1,5-Dimethyl-1H-pyrazol-3-yl)-2,2,2-trifluoroethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,5-dimethylpyrazol-3-yl)-2,2,2-trifluoroethanol (CAS 2228136-05-6) is a chemical compound with the molecular formula C7H9F3N2O and a molecular weight of 194.15 g/mol. IUPAC name: 1-(1,5-dimethylpyrazol-3-yl)-2,2,2-trifluoroethanol. InChIKey: XNJYTUNFMKRCDG-UHFFFAOYSA-N.
| Molecular formula | C7H9F3N2O |
|---|---|
| Molecular weight | 194.15 g/mol |
| IUPAC name | 1-(1,5-dimethylpyrazol-3-yl)-2,2,2-trifluoroethanol |
| InChIKey | XNJYTUNFMKRCDG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C)C(C(F)(F)F)O |
Computed by PubChem (NCBI)