Products 1935615-20-5
CAS 1935615-20-5 appears in our catalog under these names: 5–Bromo–7–methylbenzo(b)thiophene–2–carboxylic acid, 5-Bromo-7-Methylbenzo[b]Thiophene-2-Carboxylic Acid, 97%, 97%, 5-Bromo-7-methylbenzo[b]thiophene-2-carboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
5-bromo-7-methyl-1-benzothiophene-2-carboxylic acid (CAS 1935615-20-5) is a chemical compound with the molecular formula C10H7BrO2S and a molecular weight of 271.13 g/mol. IUPAC name: 5-bromo-7-methyl-1-benzothiophene-2-carboxylic acid. InChIKey: GBXUGOGSOJXPTL-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO2S |
|---|---|
| Molecular weight | 271.13 g/mol |
| IUPAC name | 5-bromo-7-methyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | GBXUGOGSOJXPTL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1SC(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)