CAS 1935813-29-8 is the registry number for N-(2,2-Dimethylthietan-3-yl)-1H-1,2,3-triazole-4-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,2-dimethylthietan-3-yl)-2H-triazole-4-carboxamide (CAS 1935813-29-8) is a chemical compound with the molecular formula C8H12N4OS and a molecular weight of 212.27 g/mol. IUPAC name: N-(2,2-dimethylthietan-3-yl)-2H-triazole-4-carboxamide. InChIKey: CYGGORDWSUFGMP-UHFFFAOYSA-N.
| Molecular formula | C8H12N4OS |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | N-(2,2-dimethylthietan-3-yl)-2H-triazole-4-carboxamide |
| InChIKey | CYGGORDWSUFGMP-UHFFFAOYSA-N |
| SMILES | CC1(C(CS1)NC(=O)C2=NNN=C2)C |
Computed by PubChem (NCBI)