Products 60458-71-1

CAS 60458-71-1 is the registry number for (4,6-Dimethyl-pyrimidin-2-ylsulfanyl)-acetic acid hydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.

Structural formula: {0} (CAS {1})

2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetohydrazide (CAS 60458-71-1) is a chemical compound with the molecular formula C8H12N4OS and a molecular weight of 212.27 g/mol. IUPAC name: 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetohydrazide. InChIKey: RLCZMVPGNOZVLO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N4OS
Molecular weight212.27 g/mol
IUPAC name2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetohydrazide
InChIKeyRLCZMVPGNOZVLO-UHFFFAOYSA-N
SMILESCC1=CC(=NC(=N1)SCC(=O)NN)C

Computed by PubChem (NCBI)