CAS 1935891-49-8 appears in our catalog under these names: 2-Amino-5-bromo-6-methoxynicotinic acid, 97%, 2-amino-5-bromo-6-methoxy-pyridine-3-carboxylic acid, 96%, 96%, 2-Amino-5-bromo-6-methoxynicotinic acid, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg, 500mg.
2-amino-5-bromo-6-methoxypyridine-3-carboxylic acid (CAS 1935891-49-8) is a chemical compound with the molecular formula C7H7BrN2O3 and a molecular weight of 247.05 g/mol. IUPAC name: 2-amino-5-bromo-6-methoxypyridine-3-carboxylic acid. InChIKey: WZJLNCJISKSABO-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O3 |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 2-amino-5-bromo-6-methoxypyridine-3-carboxylic acid |
| InChIKey | WZJLNCJISKSABO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=N1)N)C(=O)O)Br |
Computed by PubChem (NCBI)