Products 1935922-41-0
CAS 1935922-41-0 appears in our catalog under these names: 4-Bromo-3-(fluorosulfonyl)benzoic acid 95%, 4-Bromo-3-(fluorosulfonyl)benzoic acid, 95%, 95%, 4-BROMO-3-(FLUOROSULFONYL)BENZOIC ACID, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-3-fluorosulfonylbenzoic acid (CAS 1935922-41-0) is a chemical compound with the molecular formula C7H4BrFO4S and a molecular weight of 283.07 g/mol. IUPAC name: 4-bromo-3-fluorosulfonylbenzoic acid. InChIKey: WPZTZMWUYUGLKJ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO4S |
|---|---|
| Molecular weight | 283.07 g/mol |
| IUPAC name | 4-bromo-3-fluorosulfonylbenzoic acid |
| InChIKey | WPZTZMWUYUGLKJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)S(=O)(=O)F)Br |
Computed by PubChem (NCBI)