CAS 2138402-24-9 is the registry number for 3-Bromo-5-(fluorosulfonyl)benzoic acid 97+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-5-fluorosulfonylbenzoic acid (CAS 2138402-24-9) is a chemical compound with the molecular formula C7H4BrFO4S and a molecular weight of 283.07 g/mol. IUPAC name: 3-bromo-5-fluorosulfonylbenzoic acid. InChIKey: OOOSRFAVVDTFLB-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO4S |
|---|---|
| Molecular weight | 283.07 g/mol |
| IUPAC name | 3-bromo-5-fluorosulfonylbenzoic acid |
| InChIKey | OOOSRFAVVDTFLB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1S(=O)(=O)F)Br)C(=O)O |
Computed by PubChem (NCBI)