CAS 1935987-70-4 is the registry number for 3-(2-Bromoethyl)-1,2-benzothiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2-bromoethyl)-1,2-benzothiazole (CAS 1935987-70-4) is a chemical compound with the molecular formula C9H8BrNS and a molecular weight of 242.14 g/mol. IUPAC name: 3-(2-bromoethyl)-1,2-benzothiazole. InChIKey: SNDWYLIKMOUFFZ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNS |
|---|---|
| Molecular weight | 242.14 g/mol |
| IUPAC name | 3-(2-bromoethyl)-1,2-benzothiazole |
| InChIKey | SNDWYLIKMOUFFZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NS2)CCBr |
Computed by PubChem (NCBI)