CAS 193604-45-4 is the registry number for N8-Norposiphen. Offered by: TRC. Available pack sizes: 25mg.
[(3aR,8bS)-8b-methyl-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indol-7-yl] N-phenylcarbamate (CAS 193604-45-4) is a chemical compound with the molecular formula C18H19N3O2 and a molecular weight of 309.4 g/mol. IUPAC name: [(3aR,8bS)-8b-methyl-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indol-7-yl] N-phenylcarbamate. InChIKey: ZTNAPMRRYAYAIK-AEFFLSMTSA-N.
| Molecular formula | C18H19N3O2 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | [(3aR,8bS)-8b-methyl-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indol-7-yl] N-phenylcarbamate |
| InChIKey | ZTNAPMRRYAYAIK-AEFFLSMTSA-N |
| SMILES | C[C@@]12CCN[C@@H]1NC3=C2C=C(C=C3)OC(=O)NC4=CC=CC=C4 |
Computed by PubChem (NCBI)