Products 1936134-98-3
CAS 1936134-98-3 is the registry number for 7-Fluoro-1,1-dimethyl-1h-inden-5-yl-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-fluoro-1,1-dimethylinden-5-amine (CAS 1936134-98-3) is a chemical compound with the molecular formula C11H12FN and a molecular weight of 177.22 g/mol. IUPAC name: 7-fluoro-1,1-dimethylinden-5-amine. InChIKey: YMPXJEFJASLYNC-UHFFFAOYSA-N.
| Molecular formula | C11H12FN |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | 7-fluoro-1,1-dimethylinden-5-amine |
| InChIKey | YMPXJEFJASLYNC-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C1C(=CC(=C2)N)F)C |
Computed by PubChem (NCBI)