Products 1936166-14-1
CAS 1936166-14-1 is the registry number for 7-Fluoro-1,1-dimethyl-1h-inden-4-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
7-fluoro-1,1-dimethylinden-4-amine (CAS 1936166-14-1) is a chemical compound with the molecular formula C11H12FN and a molecular weight of 177.22 g/mol. IUPAC name: 7-fluoro-1,1-dimethylinden-4-amine. InChIKey: JWIYZDANYVPIIJ-UHFFFAOYSA-N.
| Molecular formula | C11H12FN |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | 7-fluoro-1,1-dimethylinden-4-amine |
| InChIKey | JWIYZDANYVPIIJ-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(C=CC(=C21)F)N)C |
Computed by PubChem (NCBI)