CAS 1936149-13-1 is the registry number for TERT-BUTYL 2-BROMO-7,7-DIMETHYL-4,5-DIHYDROTHIENO(2,3-C)PYRIDINE-6(7H)-CARBOXYLATE, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Tert-butyl 2-bromo-7,7-dimethyl-4,5-dihydrothieno[2,3-c]pyridine-6-carboxylate (CAS 1936149-13-1) is a chemical compound with the molecular formula C14H20BrNO2S and a molecular weight of 346.29 g/mol. IUPAC name: tert-butyl 2-bromo-7,7-dimethyl-4,5-dihydrothieno[2,3-c]pyridine-6-carboxylate. InChIKey: HZDQZAWSEUPAGM-UHFFFAOYSA-N.
| Molecular formula | C14H20BrNO2S |
|---|---|
| Molecular weight | 346.29 g/mol |
| IUPAC name | tert-butyl 2-bromo-7,7-dimethyl-4,5-dihydrothieno[2,3-c]pyridine-6-carboxylate |
| InChIKey | HZDQZAWSEUPAGM-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CCN1C(=O)OC(C)(C)C)C=C(S2)Br)C |
Computed by PubChem (NCBI)