CAS 2504203-49-8 is the registry number for 4-(4-Bromophenyl)-1-(isopropylsulfonyl)piperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-(4-bromophenyl)-1-propan-2-ylsulfonylpiperidine (CAS 2504203-49-8) is a chemical compound with the molecular formula C14H20BrNO2S and a molecular weight of 346.29 g/mol. IUPAC name: 4-(4-bromophenyl)-1-propan-2-ylsulfonylpiperidine. InChIKey: OHISQBGXNGBDKI-UHFFFAOYSA-N.
| Molecular formula | C14H20BrNO2S |
|---|---|
| Molecular weight | 346.29 g/mol |
| IUPAC name | 4-(4-bromophenyl)-1-propan-2-ylsulfonylpiperidine |
| InChIKey | OHISQBGXNGBDKI-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)N1CCC(CC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)