CAS 1936290-08-2 is the registry number for 6-Bromo-5-chloro-3-nitropyridin-2-amine, 97%. Offered by: AmBeed. Available pack sizes: 5g.
6-bromo-5-chloro-3-nitropyridin-2-amine (CAS 1936290-08-2) is a chemical compound with the molecular formula C5H3BrClN3O2 and a molecular weight of 252.45 g/mol. IUPAC name: 6-bromo-5-chloro-3-nitropyridin-2-amine. InChIKey: LWEOSQGKWLNBHG-UHFFFAOYSA-N.
| Molecular formula | C5H3BrClN3O2 |
|---|---|
| Molecular weight | 252.45 g/mol |
| IUPAC name | 6-bromo-5-chloro-3-nitropyridin-2-amine |
| InChIKey | LWEOSQGKWLNBHG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Cl)Br)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)